* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINGESTANOL |
| CAS: | 10592-65-1 |
| English Synonyms: | QUINGESTANOL |
| MDL Number.: | MFCD09837736 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C[C@]12CCC(=CC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@]4(C#C)O)C)OC5CCCC5 |
| InChi: | InChI=1S/C26H36O2/c1-4-26(27)16-13-23-21-10-9-18-17-20(28-19-7-5-6-8-19)11-14-24(18,2)22(21)12-15-25(23,26)3/h1,9,17,19,21-23,27H,5-8,10-16H2,2-3H3/t21-,22+,23+,24+,25+,26-/m1/s1 |
| InChiKey: | InChIKey=PUOGCRJYWLRILD-QVVPNYEUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.