* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | APRICITABINE |
CAS: | 160707-69-7 |
English Synonyms: | APRICITABINE ; SPD 754 ; AVX 754 |
MDL Number.: | MFCD09837753 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cn(c(=O)nc1N)[C@H]2CO[C@H](S2)CO |
InChi: | InChI=1S/C8H11N3O3S/c9-5-1-2-11(8(13)10-5)6-4-14-7(3-12)15-6/h1-2,6-7,12H,3-4H2,(H2,9,10,13)/t6-,7-/m1/s1 |
InChiKey: | InChIKey=RYMCFYKJDVMSIR-RNFRBKRXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.