* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZOSUQUIDAR |
CAS: | 167465-36-3 ;167354-40-7 ;167354-41-8 |
English Synonyms: | ZOSUQUIDAR(3HCL) ; ZOSUQUIDAR |
MDL Number.: | MFCD09837761 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)[C@@H](c3ccccc3[C@@H]4[C@H]2C4(F)F)N5CCN(CC5)C[C@H](COc6cccc7c6cccn7)O |
InChi: | InChI=1S/C32H31F2N3O2/c33-32(34)29-22-7-1-3-9-24(22)31(25-10-4-2-8-23(25)30(29)32)37-17-15-36(16-18-37)19-21(38)20-39-28-13-5-12-27-26(28)11-6-14-35-27/h1-14,21,29-31,38H,15-20H2/t21-,29-,30+,31-/m1/s1 |
InChiKey: | InChIKey=IHOVFYSQUDPMCN-DBEBIPAYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.