* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WITHACNISTIN |
CAS: | 21902-99-8 |
English Synonyms: | WITHACNISTIN |
MDL Number.: | MFCD09837835 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC1=C(C(=O)O[C@H](C1)[C@@H](C)[C@H]2CC[C@@H]3[C@@]2(CC[C@H]4[C@H]3C[C@@H]5[C@]6([C@@]4(C(=O)C=C[C@@H]6O)C)O5)COC(=O)C)C |
InChi: | InChI=1S/C30H40O7/c1-15-12-23(36-27(34)16(15)2)17(3)20-6-7-22-19-13-26-30(37-26)25(33)9-8-24(32)28(30,5)21(19)10-11-29(20,22)14-35-18(4)31/h8-9,17,19-23,25-26,33H,6-7,10-14H2,1-5H3/t17-,19+,20+,21-,22-,23+,25-,26+,28-,29-,30+/m0/s1 |
InChiKey: | InChIKey=ZQEYWCXMRUYTGT-ODBZFNPSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.