* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BRUCEOLIDE |
| CAS: | 25514-28-7 |
| English Synonyms: | BRUCEOLIDE |
| MDL Number.: | MFCD09837866 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | CC1=C(C(=O)C[C@]2([C@H]1C[C@@H]3[C@]45[C@@H]2[C@H]([C@@H]([C@]([C@@H]4[C@H](C(=O)O3)O)(OC5)C(=O)OC)O)O)C)O |
| InChi: | InChI=1S/C21H26O10/c1-7-8-4-10-20-6-30-21(18(28)29-3,15(20)13(25)17(27)31-10)16(26)12(24)14(20)19(8,2)5-9(22)11(7)23/h8,10,12-16,23-26H,4-6H2,1-3H3/t8-,10+,12+,13+,14+,15+,16-,19-,20+,21-/m0/s1 |
| InChiKey: | InChIKey=YLWQKYSDNGHLAO-PWRINDRCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.