* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ANAGESTONE |
CAS: | 2740-52-5 |
English Synonyms: | ANAGESTONE |
MDL Number.: | MFCD09837881 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C[C@H]1C[C@@H]2[C@H](CC[C@]3([C@H]2CC[C@@]3(C(=O)C)O)C)[C@@]4(C1=CCCC4)C |
InChi: | InChI=1S/C22H34O2/c1-14-13-16-18(20(3)10-6-5-7-17(14)20)8-11-21(4)19(16)9-12-22(21,24)15(2)23/h7,14,16,18-19,24H,5-6,8-13H2,1-4H3/t14-,16+,18-,19-,20-,21-,22-/m0/s1 |
InChiKey: | InChIKey=GAIHSQSRHYQICG-DACBVQKSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.