* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JATROPHONE |
CAS: | 29444-03-9 |
English Synonyms: | JATROPHONE |
MDL Number.: | MFCD09837890 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C[C@@H]1C[C@@]23C(=C1)/C=C(\C(=O)/C=C/C(CC(=C(C2=O)C)O3)(C)C)/C |
InChi: | InChI=1S/C20H24O3/c1-12-8-15-9-13(2)16(21)6-7-19(4,5)11-17-14(3)18(22)20(15,10-12)23-17/h6-9,12H,10-11H2,1-5H3/b7-6+,13-9-/t12-,20+/m0/s1 |
InChiKey: | InChIKey=MJNNONLDVCCGCA-ZQHAHMAHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.