* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUTEDRONIC ACID |
| CAS: | 51395-42-7 |
| English Synonyms: | BUTEDRONIC ACID |
| MDL Number.: | MFCD09837954 |
| H bond acceptor: | 10 |
| H bond donor: | 6 |
| Smile: | C(C(C(P(=O)(O)O)P(=O)(O)O)C(=O)O)C(=O)O |
| InChi: | InChI=1S/C5H10O10P2/c6-3(7)1-2(4(8)9)5(16(10,11)12)17(13,14)15/h2,5H,1H2,(H,6,7)(H,8,9)(H2,10,11,12)(H2,13,14,15) |
| InChiKey: | InChIKey=LDTZSTJLVYBEKB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.