* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ALLAMANDIN |
CAS: | 51820-82-7 |
English Synonyms: | ALLAMANDIN |
MDL Number.: | MFCD09837956 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | C/C=C/1\[C@H]2[C@@]3(C=C[C@H]4[C@@H]3[C@@H](O2)O[C@@H]([C@H]4C(=O)OC)O)OC1=O |
InChi: | InChI=1S/C15H16O7/c1-3-6-10-15(22-11(6)16)5-4-7-8(12(17)19-2)13(18)21-14(20-10)9(7)15/h3-5,7-10,13-14,18H,1-2H3/b6-3+/t7-,8-,9-,10+,13+,14+,15+/m1/s1 |
InChiKey: | InChIKey=UEOKCUGZTJHPBW-AAKUPCIZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.