* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ALMURTIDE |
CAS: | 61136-12-7 |
English Synonyms: | ALMURTIDE |
MDL Number.: | MFCD09838001 |
H bond acceptor: | 15 |
H bond donor: | 8 |
Smile: | C[C@@H](C(=O)N[C@H](CCC(=O)O)C(=O)N)NC(=O)CO[C@@H]1[C@H](C(O[C@@H]([C@H]1O)CO)O)NC(=O)C |
InChi: | InChI=1S/C18H30N4O11/c1-7(17(30)22-9(16(19)29)3-4-12(26)27)20-11(25)6-32-15-13(21-8(2)24)18(31)33-10(5-23)14(15)28/h7,9-10,13-15,18,23,28,31H,3-6H2,1-2H3,(H2,19,29)(H,20,25)(H,21,24)(H,22,30)(H,26,27)/t7-,9+,10+,13+,14+,15+,18?/m0/s1 |
InChiKey: | InChIKey=KCUSRWLYTAYGAU-KQSQHPHMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.