* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WIN 45164 |
CAS: | 83880-39-1 |
English Synonyms: | WIN 45164 |
MDL Number.: | MFCD09838080 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC(=O)C1CC=C2C(C1C(=O)C)CCC3=Cc4c(cnn4c5ccc(cc5)F)CC32C |
InChi: | InChI=1S/C26H27FN2O2/c1-15(30)21-10-11-23-22(25(21)16(2)31)9-4-18-12-24-17(13-26(18,23)3)14-28-29(24)20-7-5-19(27)6-8-20/h5-8,11-12,14,21-22,25H,4,9-10,13H2,1-3H3 |
InChiKey: | InChIKey=FMYJTJNSCOXCIK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.