* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WIN 45306 |
CAS: | 83982-91-6 |
English Synonyms: | WIN 45306 |
MDL Number.: | MFCD09838083 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | C[C@]12Cc3cnn(c3C=C1CC[C@H]4C2=CCC5(O4)C(=O)NC(=O)NC5=O)c6ccc(cc6)F |
InChi: | InChI=1S/C24H21FN4O4/c1-23-11-13-12-26-29(16-5-3-15(25)4-6-16)18(13)10-14(23)2-7-19-17(23)8-9-24(33-19)20(30)27-22(32)28-21(24)31/h3-6,8,10,12,19H,2,7,9,11H2,1H3,(H2,27,28,30,31,32)/t19-,23-/m0/s1 |
InChiKey: | InChIKey=XMHOHVNPOLECAR-CVDCTZTESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.