* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SUMILIZER AG 80 |
| CAS: | 90498-90-1 |
| English Synonyms: | SUMILIZER AG 80 |
| MDL Number.: | MFCD09838745 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | Cc1cc(cc(c1O)C(C)(C)C)CCC(=O)OCC(C)(C)C2OCC3(CO2)COC(OC3)C(C)(C)COC(=O)CCc4cc(c(c(c4)C(C)(C)C)O)C |
| InChi: | InChI=1S/C43H64O10/c1-27-17-29(19-31(35(27)46)39(3,4)5)13-15-33(44)48-21-41(9,10)37-50-23-43(24-51-37)25-52-38(53-26-43)42(11,12)22-49-34(45)16-14-30-18-28(2)36(47)32(20-30)40(6,7)8/h17-20,37-38,46-47H,13-16,21-26H2,1-12H3 |
| InChiKey: | InChIKey=CGRTZESQZZGAAU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.