* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INDANE-1-ONE, 5-(1H-TETRAZOL-1-YL)- |
| CAS: | 1131622-29-1 |
| English Synonyms: | INDANE-1-ONE, 5-(1H-TETRAZOL-1-YL)- ; 5-(1H-TETRAZOL-1-YL)-INDANE-1-ONE |
| MDL Number.: | MFCD09842478 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | c1cc2c(cc1n3cnnn3)CCC2=O |
| InChi: | InChI=1S/C10H8N4O/c15-10-4-1-7-5-8(2-3-9(7)10)14-6-11-12-13-14/h2-3,5-6H,1,4H2 |
| InChiKey: | InChIKey=FZYKWZHAQLCFPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.