* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-HYDROXY-4H-PYRAN-4-ONE |
| CAS: | 496-63-9 |
| English Synonyms: | 3-HYDROXYPYRAN-4-ONE ; 3-HYDROXY-4H-PYRAN-4-ONE |
| MDL Number.: | MFCD09863957 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cocc(c1=O)O |
| InChi: | InChI=1S/C5H4O3/c6-4-1-2-8-3-5(4)7/h1-3,7H |
| InChiKey: | InChIKey=VEYIMQVTPXPUHA-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.