* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRIDO[2,3-B]PYRAZIN-7-AMINE |
| CAS: | 804551-62-0 |
| English Synonyms: | PYRIDO[2,3-B]PYRAZIN-7-AMINE ; 7-AMINOPYRIDO[2,3-B]PYRAZINE |
| MDL Number.: | MFCD09870068 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cnc2c(n1)cc(cn2)N |
| InChi: | InChI=1S/C7H6N4/c8-5-3-6-7(11-4-5)10-2-1-9-6/h1-4H,8H2 |
| InChiKey: | InChIKey=QAHXHCJENQEPHB-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.