* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3'-METHOXY-2-NITRO-BIPHENYL |
| CAS: | 92017-95-3 |
| English Synonyms: | 3'-METHOXY-2-NITRO-BIPHENYL |
| MDL Number.: | MFCD09909439 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | COc1cccc(c1)c2ccccc2[N+](=O)[O-] |
| InChi: | InChI=1S/C13H11NO3/c1-17-11-6-4-5-10(9-11)12-7-2-3-8-13(12)14(15)16/h2-9H,1H3 |
| InChiKey: | InChIKey=FXCKQJIDZUXYTI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.