* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,6-DI-TERT-BUTYLFLUORENONE |
| CAS: | 58775-15-8 |
| English Synonyms: | 3,6-DI-TERT-BUTYLFLUORENONE |
| MDL Number.: | MFCD09909562 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(C)(C)c1ccc2c(c1)C3=CC(=CC(=O)C3=C2)C(C)(C)C |
| InChi: | InChI=1S/C21H24O/c1-20(2,3)14-8-7-13-9-18-17(16(13)10-14)11-15(12-19(18)22)21(4,5)6/h7-12H,1-6H3 |
| InChiKey: | InChIKey=RCCHXRCXYHXEQY-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.