* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB000799 |
| English Synonyms: | VITAS-BB TBB000799 |
| MDL Number.: | MFCD09910463 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CN1CCN(CCC(=O)N\N=C(/C)C2=CC=CC=N2)CC1 |
| InChi: | InChI=1S/C15H23N5O/c1-13(14-5-3-4-7-16-14)17-18-15(21)6-8-20-11-9-19(2)10-12-20/h3-5,7H,6,8-12H2,1-2H3,(H,18,21)/b17-13+ |
| InChiKey: | InChIKey=DTLKPKKWHLVXDB-GHRIWEEISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.