* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB000817 |
| English Synonyms: | VITAS-BB TBB000817 |
| MDL Number.: | MFCD09910477 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | [K+].NC1=NN=C(COC2=CC=C(C=C2)S([O-])(=O)=O)S1 |
| InChi: | InChI=1S/C9H9N3O4S2.K/c10-9-12-11-8(17-9)5-16-6-1-3-7(4-2-6)18(13,14)15;/h1-4H,5H2,(H2,10,12)(H,13,14,15);/q;+1/p-1 |
| InChiKey: | InChIKey=RRALKAJXYUPKSX-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.