* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10034362 |
English Synonyms: | SELENA SEL10034362 |
MDL Number.: | MFCD09934062 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)N(CC/C(=N/O)/N)c2ccncc2 |
InChi: | InChI=1S/C14H16N4O/c15-14(17-19)8-11-18(12-4-2-1-3-5-12)13-6-9-16-10-7-13/h1-7,9-10,19H,8,11H2,(H2,15,17) |
InChiKey: | InChIKey=LLURMBLKKIAYDD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.