* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10034582 |
English Synonyms: | SELENA SEL10034582 |
MDL Number.: | MFCD09934678 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1csc(n1)N(CC/C(=N/O)/N)c2ccccc2 |
InChi: | InChI=1S/C13H16N4OS/c1-10-9-19-13(15-10)17(8-7-12(14)16-18)11-5-3-2-4-6-11/h2-6,9,18H,7-8H2,1H3,(H2,14,16) |
InChiKey: | InChIKey=FHHYUSQVNRSXFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.