* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHOXY-1H,2H,3H,4H,4AH,5H,6H,10BH-BENZO[H]QUINOLINE |
English Synonyms: | 8-METHOXY-1H,2H,3H,4H,4AH,5H,6H,10BH-BENZO[H]QUINOLINE |
MDL Number.: | MFCD09934986 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | COc1ccc2c(c1)CCC3C2NCCC3 |
InChi: | InChI=1S/C14H19NO/c1-16-12-6-7-13-11(9-12)5-4-10-3-2-8-15-14(10)13/h6-7,9-10,14-15H,2-5,8H2,1H3 |
InChiKey: | InChIKey=NOGXPSWYTUIFBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.