* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10778157 |
English Synonyms: | SELENA SEL10778157 |
MDL Number.: | MFCD09937781 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(C)CCOc1ccc(cc1)C/C(=N/O)/N |
InChi: | InChI=1S/C13H20N2O2/c1-10(2)7-8-17-12-5-3-11(4-6-12)9-13(14)15-16/h3-6,10,16H,7-9H2,1-2H3,(H2,14,15) |
InChiKey: | InChIKey=CDYSKWRKOVLCLR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.