* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-PSICOSE |
CAS: | 16354-64-6 |
English Synonyms: | L-PSICOSE |
MDL Number.: | MFCD09951919 |
H bond acceptor: | 6 |
H bond donor: | 5 |
Smile: | C1[C@@H]([C@@H]([C@@H](C(O1)(CO)O)O)O)O |
InChi: | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4-,5-,6?/m0/s1 |
InChiKey: | InChIKey=LKDRXBCSQODPBY-NNXAEHONSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.