Molecular Structure:
CCD No.:CCD00897147
VERLUKAST-D6
CAS No.:
153698-86-3
Formula:C26 H21 Cl D6 N2 O3 S2
MolWeight:521.132
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | VERLUKAST-D6 |
| CAS： | 153698-86-3 |
| English Synonyms： | R-(-)-MK 571-D6 ; VERLUKAST-D6 ; MK 679-D6 ; 3-[[(R)-[3-[(1E)-2-(7-CHLORO-2-QUINOLINYL)ETHENYL]PHENYL][[3-(DI(METHYL-D3)AMINO)-3-OXOPROPYL]THIO]METHYL]THIO]-PROPANOIC ACID ; L 668019-D6 |
| MDL Number.： | MFCD09952297 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | [2H]C([2H])([2H])N(C(=O)CCSCS[C@H](CC(=O)O)c1cccc(c1)/C=C/c2ccc3ccc(cc3n2)Cl)C([2H])([2H])[2H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
