* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(L-MENTHOXY)-2-METHYLPROPANE-1,2-DIOL |
| CAS: | 195863-84-4 |
| English Synonyms: | 3-(L-MENTHOXY)-2-METHYLPROPANE-1,2-DIOL |
| MDL Number.: | MFCD09952338 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C[C@@H]1CC[C@H]([C@@H](C1)OCC(C)(CO)O)C(C)C |
| InChi: | InChI=1S/C14H28O3/c1-10(2)12-6-5-11(3)7-13(12)17-9-14(4,16)8-15/h10-13,15-16H,5-9H2,1-4H3/t11-,12+,13-,14?/m1/s1 |
| InChiKey: | InChIKey=XCNCWOPROFTLGU-RBKKPWLPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.