* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHYTOLACCAGENIN |
| CAS: | 1802-12-6 |
| English Synonyms: | PHYTOLACCAGENIN |
| MDL Number.: | MFCD09953799 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | C[C@@]1(CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(C[C@@H]([C@@H]([C@@]5(C)CO)O)O)C)C)[C@@H]2C1)C)C(=O)O)C(=O)OC |
| InChi: | InChI=1S/C31H48O7/c1-26(25(37)38-6)11-13-31(24(35)36)14-12-29(4)18(19(31)15-26)7-8-22-27(2)16-20(33)23(34)28(3,17-32)21(27)9-10-30(22,29)5/h7,19-23,32-34H,8-17H2,1-6H3,(H,35,36)/t19-,20-,21+,22+,23-,26-,27-,28-,29+,30+,31-/m0/s1 |
| InChiKey: | InChIKey=CYJWWQALTIKOAG-FLORRLIPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.