* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ATRACTYLODINOL |
CAS: | 61642-89-5 |
English Synonyms: | ATRACTYLODINOL ; (2E,8E)-9-(FURAN-2-YL)NONA-2,8-DIEN-4,6-DIYN-1-OL |
MDL Number.: | MFCD09953805 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(oc1)/C=C/C#CC#C/C=C/CO |
InChi: | InChI=1S/C13H10O2/c14-11-7-5-3-1-2-4-6-9-13-10-8-12-15-13/h5-10,12,14H,11H2/b7-5+,9-6+ |
InChiKey: | InChIKey=JPWHLNBWBPJJJN-PDTNFJSOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.