* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BREFELDIN C |
| CAS: | 73899-78-2 |
| English Synonyms: | BREFELDIN C |
| MDL Number.: | MFCD09954097 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C[C@H]1CCC/C=C/[C@@H]2CCC[C@H]2[C@H](/C=C/C(=O)O1)O |
| InChi: | InChI=1S/C16H24O3/c1-12-6-3-2-4-7-13-8-5-9-14(13)15(17)10-11-16(18)19-12/h4,7,10-15,17H,2-3,5-6,8-9H2,1H3/b7-4+,11-10+/t12-,13+,14+,15-/m0/s1 |
| InChiKey: | InChIKey=DDFOHHVPBOQQDW-XTFHZJJHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.