* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ILEPATRIL |
CAS: | 473289-62-2 |
English Synonyms: | ILEPATRIL |
MDL Number.: | MFCD09954127 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CC(C)[C@@H](C(=O)N[C@H]1Cc2ccccc2[C@H]3CCC[C@H](N3C1=O)C(=O)O)SC(=O)C |
InChi: | InChI=1S/C22H28N2O5S/c1-12(2)19(30-13(3)25)20(26)23-16-11-14-7-4-5-8-15(14)17-9-6-10-18(22(28)29)24(17)21(16)27/h4-5,7-8,12,16-19H,6,9-11H2,1-3H3,(H,23,26)(H,28,29)/t16-,17+,18-,19-/m0/s1 |
InChiKey: | InChIKey=FXKFFTMLFPWYFH-RDGPPVDQSA-N |
Property |
|
Safety information |
|
Symbol: | GHS07 |
Signal word: | Warning |
Hazard statements: | H302 |
hazard symbol: | Xn |
Risk Code: | R:R22 |
Safe Code: | S:S24/25 |
WGK Germany: | 1 |
* If the product has intellectual property rights, a license granted is must or contact us.