* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | MIRODENAFIL |
| CAS: | 862189-95-5 |
| English Synonyms: | MIRODENAFIL |
| MDL Number.: | MFCD09954134 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | CCCc1cn(c2c1nc([nH]c2=O)c3cc(ccc3OCCC)S(=O)(=O)N4CCN(CC4)CCO)CC |
| InChi: | InChI=1S/C26H37N5O5S/c1-4-7-19-18-30(6-3)24-23(19)27-25(28-26(24)33)21-17-20(8-9-22(21)36-16-5-2)37(34,35)31-12-10-29(11-13-31)14-15-32/h8-9,17-18,32H,4-7,10-16H2,1-3H3,(H,27,28,33) |
| InChiKey: | InChIKey=MIJFNYMSCFYZNY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.