* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SOFIGATRAN |
| CAS: | 187602-11-5 |
| English Synonyms: | SOFIGATRAN |
| MDL Number.: | MFCD09954144 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CCCOC(=O)N[C@@H](C(=O)N1CCC[C@H]1C(=O)NC[C@@H]2CC[C@H](CC2)N)C(C)(C)SC(C)C |
| InChi: | InChI=1S/C24H44N4O4S/c1-6-14-32-23(31)27-20(24(4,5)33-16(2)3)22(30)28-13-7-8-19(28)21(29)26-15-17-9-11-18(25)12-10-17/h16-20H,6-15,25H2,1-5H3,(H,26,29)(H,27,31)/t17-,18-,19-,20-/m0/s1 |
| InChiKey: | InChIKey=MNMZVSQUWOILCZ-MUGJNUQGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.