* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VABICASERIN |
| CAS: | 620948-93-8 |
| English Synonyms: | VABICASERIN |
| MDL Number.: | MFCD09954152 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc2c3c(c1)[C@H]4CCC[C@H]4CN3CCNC2 |
| InChi: | InChI=1S/C15H20N2/c1-3-11-9-16-7-8-17-10-12-4-2-5-13(12)14(6-1)15(11)17/h1,3,6,12-13,16H,2,4-5,7-10H2/t12-,13-/m0/s1 |
| InChiKey: | InChIKey=NPTIPEQJIDTVKR-STQMWFEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.