* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VAPITADINE |
| CAS: | 793655-64-8 |
| English Synonyms: | VAPITADINE ; 4',7'-DIAZASPIRO[PIPERIDINE-4,2'-TRICYCLO[8.4.0.0(3,7)]TETRADECANE]-1'(10'),3',5',11',13'-PENTAENE-6'-CARBOXAMIDE |
| MDL Number.: | MFCD09954153 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)CCn3c(cnc3C24CCNCC4)C(=O)N |
| InChi: | InChI=1S/C17H20N4O/c18-15(22)14-11-20-16-17(6-8-19-9-7-17)13-4-2-1-3-12(13)5-10-21(14)16/h1-4,11,19H,5-10H2,(H2,18,22) |
| InChiKey: | InChIKey=VQWGYPVNVICKFC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.