* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FURO[2,3-C]PYRIDINE |
| CAS: | 19539-50-5 |
| English Synonyms: | FURO[2,3-C]PYRIDINE ; ABBYPHARMA AP-31-2724 |
| MDL Number.: | MFCD09955599 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cncc2c1cco2 |
| InChi: | InChI=1S/C7H5NO/c1-3-8-5-7-6(1)2-4-9-7/h1-5H |
| InChiKey: | InChIKey=ZYXBIOIYWUIXSM-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.