* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | YM-355179 |
English Synonyms: | YM-355179 |
MDL Number.: | MFCD09970276 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | OC(=O)\C=C\C(O)=O.CC1=C(N=CC(O)=C1)C(=O)N1CCC(CC1)=CC(=O)N[C@@H]1CCN(CC2=CC3=C(C=C2)C=C(F)C=C3)C1 |
InChi: | InChI=1S/C29H31FN4O3.C4H4O4/c1-19-12-26(35)16-31-28(19)29(37)34-10-6-20(7-11-34)14-27(36)32-25-8-9-33(18-25)17-21-2-3-23-15-24(30)5-4-22(23)13-21;5-3(6)1-2-4(7)8/h2-5,12-16,25,35H,6-11,17-18H2,1H3,(H,32,36);1-2H,(H,5,6)(H,7,8)/b;2-1+/t25-;/m1./s1 |
InChiKey: | InChIKey=VZXZMPWYXAOHDA-FMYYAHIMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.