* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GARDENIN D |
| CAS: | 29202-00-4 |
| English Synonyms: | GARDENIN D |
| MDL Number.: | MFCD09970382 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | COc1ccc(cc1O)c2cc(=O)c3c(c(c(c(c3o2)OC)OC)OC)O |
| InChi: | InChI=1S/C19H18O8/c1-23-12-6-5-9(7-10(12)20)13-8-11(21)14-15(22)17(24-2)19(26-4)18(25-3)16(14)27-13/h5-8,20,22H,1-4H3 |
| InChiKey: | InChIKey=DQMSOZCDDAULPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.