* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ALPHA-VINIFERIN |
CAS: | 62218-13-7 |
English Synonyms: | ALPHA-VINIFERIN |
MDL Number.: | MFCD09970467 |
H bond acceptor: | 9 |
H bond donor: | 6 |
Smile: | c1cc(ccc1[C@H]2[C@@H]3c4cc(cc5c4[C@H](c6cc(cc7c6[C@@H](c8c3c(cc(c8)O)O2)[C@@H](O7)c9ccc(cc9)O)O)[C@H](O5)c1ccc(cc1)O)O)O |
InChi: | InChI=1S/C42H30O9/c43-22-7-1-19(2-8-22)40-37-28-13-25(46)17-32-35(28)39(42(50-32)21-5-11-24(45)12-6-21)30-15-27(48)18-33-36(30)38(29-14-26(47)16-31(49-40)34(29)37)41(51-33)20-3-9-23(44)10-4-20/h1-18,37-48H/t37-,38-,39+,40+,41+,42-/m1/s1 |
InChiKey: | InChIKey=KUTVNHOAKHJJFL-ZSIJVUTGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.