* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VUF-5207 |
| English Synonyms: | [5-(1H-IMIDAZOL-4-YL)PENTYL]DIMETHYLAMINE ; VUF-5207 |
| MDL Number.: | MFCD09970577 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CN(C)CCCCCc1c[nH]cn1 |
| InChi: | InChI=1S/C10H19N3/c1-13(2)7-5-3-4-6-10-8-11-9-12-10/h8-9H,3-7H2,1-2H3,(H,11,12) |
| InChiKey: | InChIKey=MVHBNHUOEFGIBK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.