* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4H-ISOXAZOLO[3,4-D]AZEPIN-3-OL,5,6,7,8-TETRAHYDRO- |
CAS: | 58893-45-1 |
English Synonyms: | 4H-ISOXAZOLO[3,4-D]AZEPIN-3-OL,5,6,7,8-TETRAHYDRO- ; 5,6,7,8-TETRAHYDRO-4H-ISOXAZOLO[3,4-D]AZEPIN-3-OL |
MDL Number.: | MFCD09970614 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C1CNCCc2c1c(on2)O |
InChi: | InChI=1S/C7H10N2O2/c10-7-5-1-3-8-4-2-6(5)9-11-7/h8,10H,1-4H2 |
InChiKey: | InChIKey=ADCZCHGZOJHXPU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.