* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LEFRADAFIBAN |
CAS: | 149503-79-7 |
English Synonyms: | LEFRADAFIBAN |
MDL Number.: | MFCD09970834 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | COC(=O)C[C@@H]1C[C@H](NC1=O)COc2ccc(cc2)c3ccc(cc3)C(=N)NC(=O)OC |
InChi: | InChI=1S/C23H25N3O6/c1-30-20(27)12-17-11-18(25-22(17)28)13-32-19-9-7-15(8-10-19)14-3-5-16(6-4-14)21(24)26-23(29)31-2/h3-10,17-18H,11-13H2,1-2H3,(H,25,28)(H2,24,26,29)/t17-,18-/m0/s1 |
InChiKey: | InChIKey=PGCFXITVMNNKON-ROUUACIJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.