Molecular Structure:
CCD No.:CCD00901312
Y 134
CAS No.:
849662-80-2
Formula:C28 H28 N2 O3 S
MolWeight:472.606
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | Y 134 |
| CAS： | 849662-80-2 |
| English Synonyms： | Y 134 |
| MDL Number.： | MFCD09970973 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CC(C)N1CCN(CC1)c2ccc(cc2)C(=O)c3c4ccc(cc4sc3c5ccc(cc5)O)O |
| InChi： | InChI=1S/C28H28N2O3S/c1-18(2)29-13-15-30(16-14-29)21-7-3-19(4-8-21)27(33)26-24-12-11-23(32)17-25(24)34-28(26)20-5-9-22(31)10-6-20/h3-12,17-18,31-32H,13-16H2,1-2H3 |
| InChiKey： | InChIKey=LQEOPHGPHCWOAC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
