* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WAY 213613 |
CAS: | 868359-05-1 |
English Synonyms: | N4-[4-(2-BROMO-4,5-DIFLUOROPHENOXY)PHENYL]-L-ASPARAGINE ; WAY 213613 |
MDL Number.: | MFCD09971111 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | c1cc(ccc1NC(=O)C[C@@H](C(=O)O)N)Oc2cc(c(cc2Br)F)F |
InChi: | InChI=1S/C16H13BrF2N2O4/c17-10-5-11(18)12(19)6-14(10)25-9-3-1-8(2-4-9)21-15(22)7-13(20)16(23)24/h1-6,13H,7,20H2,(H,21,22)(H,23,24)/t13-/m0/s1 |
InChiKey: | InChIKey=BNYDDAAZMBUFRG-ZDUSSCGKSA-N |
|
|
|
|
Symbol: |
![]() |
Signal word: | Warning |
Hazard statements: | H302 |
hazard symbol: | Xn |
Risk Code: | R:22 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.