* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | MRS 1754 |
| CAS: | 264622-58-4 |
| English Synonyms: | MRS 1754 |
| MDL Number.: | MFCD09971130 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | CCCn1c2c(c(=O)n(c1=O)CCC)[nH]c(n2)c3ccc(cc3)OCC(=O)Nc4ccc(cc4)C#N |
| InChi: | InChI=1S/C26H26N6O4/c1-3-13-31-24-22(25(34)32(14-4-2)26(31)35)29-23(30-24)18-7-11-20(12-8-18)36-16-21(33)28-19-9-5-17(15-27)6-10-19/h5-12H,3-4,13-14,16H2,1-2H3,(H,28,33)(H,29,30) |
| InChiKey: | InChIKey=AJBBEYXFRYFVNM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.