* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-2,8-DIAZASPIRO[4.5]DECAN-3-ONE |
| CAS: | 154495-67-7 |
| English Synonyms: | 8-METHYL-2,8-DIAZASPIRO[4.5]DECAN-3-ONE ; 2,8-DIAZASPIRO[4.5]DECAN-3-ONE, 8-METHYL- |
| MDL Number.: | MFCD09971232 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CN1CCC2(CC1)CC(=O)NC2 |
| InChi: | InChI=1S/C9H16N2O/c1-11-4-2-9(3-5-11)6-8(12)10-7-9/h2-7H2,1H3,(H,10,12) |
| InChiKey: | InChIKey=VPRICBVWISBIQT-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.