* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-IODO-1-METHYL-1H-INDAZOLE |
| CAS: | 52088-10-5 |
| English Synonyms: | 1H-INDAZOLE, 3-IODO-1-METHYL- ; 3-IODO-1-METHYL-1H-INDAZOLE |
| MDL Number.: | MFCD09971239 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | Cn1c2ccccc2c(n1)I |
| InChi: | InChI=1S/C8H7IN2/c1-11-7-5-3-2-4-6(7)8(9)10-11/h2-5H,1H3 |
| InChiKey: | InChIKey=OAQYCAYEBWRHLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.