* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IMIDAZO[1,2-A]PYRIMIDIN-2-OL |
English Synonyms: | IMIDAZO[1,2-A]PYRIMIDIN-2-OL |
MDL Number.: | MFCD09994186 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cnc2nc(cn2c1)O |
InChi: | InChI=1S/C6H5N3O/c10-5-4-9-3-1-2-7-6(9)8-5/h1-4,10H |
InChiKey: | InChIKey=LKTOEPILUGDGNQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.