* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-AMINO-1,2,4-TRIAZOLO[4,3-A]PYRAZINE |
| CAS: | 68774-79-8 |
| English Synonyms: | 8-AMINO-1,2,4-TRIAZOLO[4,3-A]PYRAZINE ; [1,2,4]TRIAZOLO[4,3-A]PYRAZIN-8-AMINE |
| MDL Number.: | MFCD09999200 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1cn2cnnc2c(n1)N |
| InChi: | InChI=1S/C5H5N5/c6-4-5-9-8-3-10(5)2-1-7-4/h1-3H,(H2,6,7) |
| InChiKey: | InChIKey=RDUBUZQXHRTBOB-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.