* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-BUTYLPYRAZINAMINE |
| CAS: | 91678-85-2 |
| English Synonyms: | 3-BUTYLPYRAZINAMINE |
| MDL Number.: | MFCD09999232 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCC1=NC=CN(C1)N |
| InChi: | InChI=1S/C8H15N3/c1-2-3-4-8-7-11(9)6-5-10-8/h5-6H,2-4,7,9H2,1H3 |
| InChiKey: | InChIKey=NJOLLAVTQJZYCZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.